About 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine
2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine (PubChem CID 82820959) has the molecular formula C18H21NS
and a molecular weight of 283.44 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine |
| PubChem CID | 82820959 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine |
| SMILES | CSc1ccc(NC2c3ccccc3CC2(C)C)cc1 |
| InChI | InChI=1S/C18H21NS/c1-18(2)12-13-6-4-5-7-16(13)17(18)19-14-8-10-15(20-3)11-9-14/h4-11,17,19H,12H2,1-3H3 |
| InChIKey | MMUPMGNOYOFDBY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine?
The IUPAC name of 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine (CID 82820959) is 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine.
What is the SMILES notation for 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine?
The canonical SMILES for 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine is CSc1ccc(NC2c3ccccc3CC2(C)C)cc1.
What is the InChIKey of 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine?
The InChIKey is MMUPMGNOYOFDBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NS/c1-18(2)12-13-6-4-5-7-16(13)17(18)19-14-8-10-15(20-3)11-9-14/h4-11,17,19H,12H2,1-3H3.
What are the key properties of 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine?
2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine has a molecular weight of 283.44 g/mol, XLogP of 5.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-(4-methylsulfanylphenyl)-1,3-dihydroinden-1-amine is sourced from PubChem (CID 82820959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).