About N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine
N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine (PubChem CID 82821346) has the molecular formula C17H17ClFN
and a molecular weight of 289.78 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine |
| PubChem CID | 82821346 |
| Molecular Formula | C17H17ClFN |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine |
| SMILES | CC1(C)Cc2ccccc2C1Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C17H17ClFN/c1-17(2)10-11-5-3-4-6-13(11)16(17)20-15-9-12(18)7-8-14(15)19/h3-9,16,20H,10H2,1-2H3 |
| InChIKey | ZSUUMVRNUQMLHE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine?
The IUPAC name of N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine (CID 82821346) is N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine.
What is the SMILES notation for N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine?
The canonical SMILES for N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine is CC1(C)Cc2ccccc2C1Nc1cc(Cl)ccc1F.
What is the InChIKey of N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine?
The InChIKey is ZSUUMVRNUQMLHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClFN/c1-17(2)10-11-5-3-4-6-13(11)16(17)20-15-9-12(18)7-8-14(15)19/h3-9,16,20H,10H2,1-2H3.
What are the key properties of N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine?
N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine has a molecular weight of 289.78 g/mol, XLogP of 5.21, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2-fluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine is sourced from PubChem (CID 82821346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).