C11H12F2N6O — CID 82822031
N-(2,6-difluoro-3-methylphenyl)-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 82822031) has the molecular formula C11H12F2N6O and a molecular weight of 282.25 g/mol. Its IUPAC name is N-(2,6-difluoro-3-methylphenyl)-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(2,6-difluoro-3-methylphenyl)-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 82822031 |
| Molecular Formula | C11H12F2N6O |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(2,6-difluoro-3-methylphenyl)-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NN)nc(Nc2c(F)ccc(C)c2F)n1 |
| InChI | InChI=1S/C11H12F2N6O/c1-5-3-4-6(12)8(7(5)13)15-9-16-10(19-14)18-11(17-9)20-2/h3-4H,14H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | MZEYIDDGKGDLDJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|