About 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine
1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine (PubChem CID 82854057) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine.
Molecular Properties
| Compound Name | 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine |
| PubChem CID | 82854057 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine |
| SMILES | C=CCN(CCCCC(C)N)C(C)C |
| InChI | InChI=1S/C12H26N2/c1-5-9-14(11(2)3)10-7-6-8-12(4)13/h5,11-12H,1,6-10,13H2,2-4H3 |
| InChIKey | FFUFMLJWKYPOFQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine?
The IUPAC name of 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine (CID 82854057) is 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine.
What is the SMILES notation for 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine?
The canonical SMILES for 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine is C=CCN(CCCCC(C)N)C(C)C.
What is the InChIKey of 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine?
The InChIKey is FFUFMLJWKYPOFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-5-9-14(11(2)3)10-7-6-8-12(4)13/h5,11-12H,1,6-10,13H2,2-4H3.
What are the key properties of 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine?
1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.40, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-propan-2-yl-1-N-prop-2-enylhexane-1,5-diamine is sourced from PubChem (CID 82854057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).