C17H31N2P — CID 87749302
1-phosphanyl-N,N,N',N'-tetrakis(prop-2-enyl)pentane-1,5-diamine (PubChem CID 87749302) has the molecular formula C17H31N2P and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-phosphanyl-N,N,N',N'-tetrakis(prop-2-enyl)pentane-1,5-diamine.
| Compound Name | 1-phosphanyl-N,N,N',N'-tetrakis(prop-2-enyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 87749302 |
| Molecular Formula | C17H31N2P |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 1-phosphanyl-N,N,N',N'-tetrakis(prop-2-enyl)pentane-1,5-diamine |
| SMILES | C=CCN(CC=C)CCCCC(P)N(CC=C)CC=C |
| InChI | InChI=1S/C17H31N2P/c1-5-12-18(13-6-2)16-10-9-11-17(20)19(14-7-3)15-8-4/h5-8,17H,1-4,9-16,20H2 |
| InChIKey | HPQBCKXCVYBXDL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|