C15H19ClFNO3 — CID 82873187
6-[(3-chloro-4-fluorobenzoyl)amino]-4-ethylhexanoic acid (PubChem CID 82873187) has the molecular formula C15H19ClFNO3 and a molecular weight of 315.77 g/mol. Its IUPAC name is 6-[(3-chloro-4-fluorobenzoyl)amino]-4-ethylhexanoic acid.
| Compound Name | 6-[(3-chloro-4-fluorobenzoyl)amino]-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 82873187 |
| Molecular Formula | C15H19ClFNO3 |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 6-[(3-chloro-4-fluorobenzoyl)amino]-4-ethylhexanoic acid |
| SMILES | CCC(CCNC(=O)c1ccc(F)c(Cl)c1)CCC(=O)O |
| InChI | InChI=1S/C15H19ClFNO3/c1-2-10(3-6-14(19)20)7-8-18-15(21)11-4-5-13(17)12(16)9-11/h4-5,9-10H,2-3,6-8H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | DPALQBVNTWFWPT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |