C14H16FN3O2S — CID 82900035
4-amino-3-[(3-fluorophenyl)methyl-methylamino]benzenesulfonamide (PubChem CID 82900035) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-amino-3-[(3-fluorophenyl)methyl-methylamino]benzenesulfonamide.
| Compound Name | 4-amino-3-[(3-fluorophenyl)methyl-methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 82900035 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-amino-3-[(3-fluorophenyl)methyl-methylamino]benzenesulfonamide |
| SMILES | CN(Cc1cccc(F)c1)c1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C14H16FN3O2S/c1-18(9-10-3-2-4-11(15)7-10)14-8-12(21(17,19)20)5-6-13(14)16/h2-8H,9,16H2,1H3,(H2,17,19,20) |
| InChIKey | HNTLHGZZZDDVQQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|