C18H25BrN2 — CID 82909949
1-(3-bromoquinolin-2-yl)-N,3-diethylpentan-1-amine (PubChem CID 82909949) has the molecular formula C18H25BrN2 and a molecular weight of 349.32 g/mol. Its IUPAC name is 1-(3-bromoquinolin-2-yl)-N,3-diethylpentan-1-amine.
| Compound Name | 1-(3-bromoquinolin-2-yl)-N,3-diethylpentan-1-amine |
|---|---|
| PubChem CID | 82909949 |
| Molecular Formula | C18H25BrN2 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-(3-bromoquinolin-2-yl)-N,3-diethylpentan-1-amine |
| SMILES | CCNC(CC(CC)CC)c1nc2ccccc2cc1Br |
| InChI | InChI=1S/C18H25BrN2/c1-4-13(5-2)11-17(20-6-3)18-15(19)12-14-9-7-8-10-16(14)21-18/h7-10,12-13,17,20H,4-6,11H2,1-3H3 |
| InChIKey | IQZJXMUZJYIIDA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |