C15H14BrNO3S — CID 82914133
4-(2-bromoprop-2-enoxy)-3-phenylbenzenesulfonamide (PubChem CID 82914133) has the molecular formula C15H14BrNO3S and a molecular weight of 368.25 g/mol. Its IUPAC name is 4-(2-bromoprop-2-enoxy)-3-phenylbenzenesulfonamide.
| Compound Name | 4-(2-bromoprop-2-enoxy)-3-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 82914133 |
| Molecular Formula | C15H14BrNO3S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 4-(2-bromoprop-2-enoxy)-3-phenylbenzenesulfonamide |
| SMILES | C=C(Br)COc1ccc(S(N)(=O)=O)cc1-c1ccccc1 |
| InChI | InChI=1S/C15H14BrNO3S/c1-11(16)10-20-15-8-7-13(21(17,18)19)9-14(15)12-5-3-2-4-6-12/h2-9H,1,10H2,(H2,17,18,19) |
| InChIKey | ABESFBGDMUJCEP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |