C15H33NO3 — CID 82952304
1-[bis(2-ethoxyethyl)amino]-4,4-dimethylpentan-3-ol (PubChem CID 82952304) has the molecular formula C15H33NO3 and a molecular weight of 275.43 g/mol. Its IUPAC name is 1-[bis(2-ethoxyethyl)amino]-4,4-dimethylpentan-3-ol.
| Compound Name | 1-[bis(2-ethoxyethyl)amino]-4,4-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 82952304 |
| Molecular Formula | C15H33NO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | 1-[bis(2-ethoxyethyl)amino]-4,4-dimethylpentan-3-ol |
| SMILES | CCOCCN(CCOCC)CCC(O)C(C)(C)C |
| InChI | InChI=1S/C15H33NO3/c1-6-18-12-10-16(11-13-19-7-2)9-8-14(17)15(3,4)5/h14,17H,6-13H2,1-5H3 |
| InChIKey | WQJVRAIMKMWJJF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|