C10H12BF3O3 — CID 82953780
[2-(3,3,3-trifluoropropoxymethyl)phenyl]boronic acid (PubChem CID 82953780) has the molecular formula C10H12BF3O3 and a molecular weight of 248.01 g/mol. Its IUPAC name is [2-(3,3,3-trifluoropropoxymethyl)phenyl]boronic acid.
| Compound Name | [2-(3,3,3-trifluoropropoxymethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 82953780 |
| Molecular Formula | C10H12BF3O3 |
| Molecular Weight | 248.01 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | [2-(3,3,3-trifluoropropoxymethyl)phenyl]boronic acid |
| SMILES | OB(O)c1ccccc1COCCC(F)(F)F |
| InChI | InChI=1S/C10H12BF3O3/c12-10(13,14)5-6-17-7-8-3-1-2-4-9(8)11(15)16/h1-4,15-16H,5-7H2 |
| InChIKey | OWSNVCFJNNWRPI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.01 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|