C10H18BrF3O — CID 82955428
1-bromo-3,3-dimethyl-2-(3,3,3-trifluoropropoxymethyl)butane (PubChem CID 82955428) has the molecular formula C10H18BrF3O and a molecular weight of 291.15 g/mol. Its IUPAC name is 1-bromo-3,3-dimethyl-2-(3,3,3-trifluoropropoxymethyl)butane.
| Compound Name | 1-bromo-3,3-dimethyl-2-(3,3,3-trifluoropropoxymethyl)butane |
|---|---|
| PubChem CID | 82955428 |
| Molecular Formula | C10H18BrF3O |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-bromo-3,3-dimethyl-2-(3,3,3-trifluoropropoxymethyl)butane |
| SMILES | CC(C)(C)C(CBr)COCCC(F)(F)F |
| InChI | InChI=1S/C10H18BrF3O/c1-9(2,3)8(6-11)7-15-5-4-10(12,13)14/h8H,4-7H2,1-3H3 |
| InChIKey | RLRYZRLUCKPUKD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|