C17H25NO3 — CID 82957858
2,2-dimethyl-4-[methyl(oxan-4-yl)amino]-3,4-dihydrochromen-7-ol (PubChem CID 82957858) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2,2-dimethyl-4-[methyl(oxan-4-yl)amino]-3,4-dihydrochromen-7-ol.
| Compound Name | 2,2-dimethyl-4-[methyl(oxan-4-yl)amino]-3,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 82957858 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2,2-dimethyl-4-[methyl(oxan-4-yl)amino]-3,4-dihydrochromen-7-ol |
| SMILES | CN(C1CCOCC1)C1CC(C)(C)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C17H25NO3/c1-17(2)11-15(18(3)12-6-8-20-9-7-12)14-5-4-13(19)10-16(14)21-17/h4-5,10,12,15,19H,6-9,11H2,1-3H3 |
| InChIKey | HVEJBCZWQALLRH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |