C10H14F3N3O — CID 82958852
5-propan-2-yl-6-(3,3,3-trifluoropropoxy)pyrimidin-4-amine (PubChem CID 82958852) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is 5-propan-2-yl-6-(3,3,3-trifluoropropoxy)pyrimidin-4-amine.
| Compound Name | 5-propan-2-yl-6-(3,3,3-trifluoropropoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 82958852 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 5-propan-2-yl-6-(3,3,3-trifluoropropoxy)pyrimidin-4-amine |
| SMILES | CC(C)c1c(N)ncnc1OCCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O/c1-6(2)7-8(14)15-5-16-9(7)17-4-3-10(11,12)13/h5-6H,3-4H2,1-2H3,(H2,14,15,16) |
| InChIKey | FJIVILHWVLWOIF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |