C12H11F6N5O — CID 87547370
5-ethyl-4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 87547370) has the molecular formula C12H11F6N5O and a molecular weight of 355.24 g/mol. Its IUPAC name is 5-ethyl-4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 5-ethyl-4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 87547370 |
| Molecular Formula | C12H11F6N5O |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 5-ethyl-4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | CCc1c(OCC(F)(F)C(F)C(F)(F)F)ncnc1-n1cncn1 |
| InChI | InChI=1S/C12H11F6N5O/c1-2-7-8(23-6-19-4-22-23)20-5-21-9(7)24-3-11(14,15)10(13)12(16,17)18/h4-6,10H,2-3H2,1H3 |
| InChIKey | GGSDACKTKNOGID-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |