C8H13N3O — CID 82997095
2-amino-8-methyl-1,3-diazaspiro[4.4]non-1-en-4-one (PubChem CID 82997095) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-amino-8-methyl-1,3-diazaspiro[4.4]non-1-en-4-one.
| Compound Name | 2-amino-8-methyl-1,3-diazaspiro[4.4]non-1-en-4-one |
|---|---|
| PubChem CID | 82997095 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-amino-8-methyl-1,3-diazaspiro[4.4]non-1-en-4-one |
| SMILES | CC1CCC2(C1)N=C(N)NC2=O |
| InChI | InChI=1S/C8H13N3O/c1-5-2-3-8(4-5)6(12)10-7(9)11-8/h5H,2-4H2,1H3,(H3,9,10,11,12) |
| InChIKey | VVHDKVGCABVBRH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |