C11H19N3O — CID 82996861
2-amino-6,8,8-trimethyl-1,3-diazaspiro[4.5]dec-1-en-4-one (PubChem CID 82996861) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-amino-6,8,8-trimethyl-1,3-diazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-amino-6,8,8-trimethyl-1,3-diazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 82996861 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-amino-6,8,8-trimethyl-1,3-diazaspiro[4.5]dec-1-en-4-one |
| SMILES | CC1CC(C)(C)CCC12N=C(N)NC2=O |
| InChI | InChI=1S/C11H19N3O/c1-7-6-10(2,3)4-5-11(7)8(15)13-9(12)14-11/h7H,4-6H2,1-3H3,(H3,12,13,14,15) |
| InChIKey | GIGUEBZRTBWDIY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |