C13H18F2N2O — CID 83007673
N-[[2-(difluoromethoxy)phenyl]methyl]piperidin-1-amine (PubChem CID 83007673) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]piperidin-1-amine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]piperidin-1-amine |
|---|---|
| PubChem CID | 83007673 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]piperidin-1-amine |
| SMILES | FC(F)Oc1ccccc1CNN1CCCCC1 |
| InChI | InChI=1S/C13H18F2N2O/c14-13(15)18-12-7-3-2-6-11(12)10-16-17-8-4-1-5-9-17/h2-3,6-7,13,16H,1,4-5,8-10H2 |
| InChIKey | GOPLBZVTQBUJSM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |