C14H20F3N3O — CID 83011001
N-piperidin-1-yl-1-[2-(trifluoromethoxy)phenyl]ethane-1,2-diamine (PubChem CID 83011001) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is N-piperidin-1-yl-1-[2-(trifluoromethoxy)phenyl]ethane-1,2-diamine.
| Compound Name | N-piperidin-1-yl-1-[2-(trifluoromethoxy)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 83011001 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-piperidin-1-yl-1-[2-(trifluoromethoxy)phenyl]ethane-1,2-diamine |
| SMILES | NCC(NN1CCCCC1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H20F3N3O/c15-14(16,17)21-13-7-3-2-6-11(13)12(10-18)19-20-8-4-1-5-9-20/h2-3,6-7,12,19H,1,4-5,8-10,18H2 |
| InChIKey | UMLBYUVUGNBZQS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |