About [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine
[1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine (PubChem CID 83011915) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol. Its IUPAC name is [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine.
Molecular Properties
| Compound Name | [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine |
| PubChem CID | 83011915 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine |
| SMILES | CN(C)NC1(CN)CCC1 |
| InChI | InChI=1S/C7H17N3/c1-10(2)9-7(6-8)4-3-5-7/h9H,3-6,8H2,1-2H3 |
| InChIKey | BESXNUOIODQVKD-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine?
The IUPAC name of [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine (CID 83011915) is [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine.
What is the SMILES notation for [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine?
The canonical SMILES for [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine is CN(C)NC1(CN)CCC1.
What is the InChIKey of [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine?
The InChIKey is BESXNUOIODQVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3/c1-10(2)9-7(6-8)4-3-5-7/h9H,3-6,8H2,1-2H3.
What are the key properties of [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine?
[1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine has a molecular weight of 143.23 g/mol, XLogP of -0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethylhydrazinyl)cyclobutyl]methanamine is sourced from PubChem (CID 83011915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).