C11H15BrN2OS — CID 83047435
2-(2-bromophenyl)sulfanylpentanehydrazide (PubChem CID 83047435) has the molecular formula C11H15BrN2OS and a molecular weight of 303.22 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfanylpentanehydrazide.
| Compound Name | 2-(2-bromophenyl)sulfanylpentanehydrazide |
|---|---|
| PubChem CID | 83047435 |
| Molecular Formula | C11H15BrN2OS |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-(2-bromophenyl)sulfanylpentanehydrazide |
| SMILES | CCCC(Sc1ccccc1Br)C(=O)NN |
| InChI | InChI=1S/C11H15BrN2OS/c1-2-5-10(11(15)14-13)16-9-7-4-3-6-8(9)12/h3-4,6-7,10H,2,5,13H2,1H3,(H,14,15) |
| InChIKey | NEZCSBMHFVLIRS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|