C16H24O5 — CID 83052448
2-[1-(3,4-dimethoxyphenyl)propan-2-yl]-2-hydroxypentanoic acid (PubChem CID 83052448) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxyphenyl)propan-2-yl]-2-hydroxypentanoic acid.
| Compound Name | 2-[1-(3,4-dimethoxyphenyl)propan-2-yl]-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 83052448 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-[1-(3,4-dimethoxyphenyl)propan-2-yl]-2-hydroxypentanoic acid |
| SMILES | CCCC(O)(C(=O)O)C(C)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H24O5/c1-5-8-16(19,15(17)18)11(2)9-12-6-7-13(20-3)14(10-12)21-4/h6-7,10-11,19H,5,8-9H2,1-4H3,(H,17,18) |
| InChIKey | VSAPOHWEEOWOMZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |