About 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one
7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one (PubChem CID 83057978) has the molecular formula C18H16FNO
and a molecular weight of 281.33 g/mol. Its IUPAC name is 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one.
Molecular Properties
| Compound Name | 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one |
| PubChem CID | 83057978 |
| Molecular Formula | C18H16FNO |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one |
| SMILES | O=C1CC2(CCc3c(F)cccc32)C(c2ccccc2)N1 |
| InChI | InChI=1S/C18H16FNO/c19-15-8-4-7-14-13(15)9-10-18(14)11-16(21)20-17(18)12-5-2-1-3-6-12/h1-8,17H,9-11H2,(H,20,21) |
| InChIKey | YJJVHAKTVAHYKN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one?
The IUPAC name of 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one (CID 83057978) is 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one.
What is the SMILES notation for 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one?
The canonical SMILES for 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one is O=C1CC2(CCc3c(F)cccc32)C(c2ccccc2)N1.
What is the InChIKey of 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one?
The InChIKey is YJJVHAKTVAHYKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FNO/c19-15-8-4-7-14-13(15)9-10-18(14)11-16(21)20-17(18)12-5-2-1-3-6-12/h1-8,17H,9-11H2,(H,20,21).
What are the key properties of 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one?
7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one has a molecular weight of 281.33 g/mol, XLogP of 3.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-5'-phenylspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one is sourced from PubChem (CID 83057978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).