C11H18F3NO3S — CID 83059094
8-(4,4,4-trifluorobutylsulfonyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 83059094) has the molecular formula C11H18F3NO3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 8-(4,4,4-trifluorobutylsulfonyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-(4,4,4-trifluorobutylsulfonyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 83059094 |
| Molecular Formula | C11H18F3NO3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 8-(4,4,4-trifluorobutylsulfonyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C11H18F3NO3S/c12-11(13,14)4-1-5-19(17,18)15-8-2-3-9(15)7-10(16)6-8/h8-10,16H,1-7H2 |
| InChIKey | YUEDJDMIQYKWCB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |