C11H15F3N2O2S — CID 83068684
N-[(3-aminophenyl)methyl]-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83068684) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-[(3-aminophenyl)methyl]-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83068684 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | Nc1cccc(CNS(=O)(=O)CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3N2O2S/c12-11(13,14)5-2-6-19(17,18)16-8-9-3-1-4-10(15)7-9/h1,3-4,7,16H,2,5-6,8,15H2 |
| InChIKey | WZOCBPDXIZKOTP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|