C14H19FO3S — CID 83069176
1-(3-ethylsulfonylpropyl)-4-fluoro-2,3-dihydroinden-1-ol (PubChem CID 83069176) has the molecular formula C14H19FO3S and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-(3-ethylsulfonylpropyl)-4-fluoro-2,3-dihydroinden-1-ol.
| Compound Name | 1-(3-ethylsulfonylpropyl)-4-fluoro-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 83069176 |
| Molecular Formula | C14H19FO3S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(3-ethylsulfonylpropyl)-4-fluoro-2,3-dihydroinden-1-ol |
| SMILES | CCS(=O)(=O)CCCC1(O)CCc2c(F)cccc21 |
| InChI | InChI=1S/C14H19FO3S/c1-2-19(17,18)10-4-8-14(16)9-7-11-12(14)5-3-6-13(11)15/h3,5-6,16H,2,4,7-10H2,1H3 |
| InChIKey | AWGQNYNCRQPXLX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |