C13H17FO2 — CID 83069804
4-fluoro-1-(propoxymethyl)-2,3-dihydroinden-1-ol (PubChem CID 83069804) has the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 4-fluoro-1-(propoxymethyl)-2,3-dihydroinden-1-ol.
| Compound Name | 4-fluoro-1-(propoxymethyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 83069804 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 4-fluoro-1-(propoxymethyl)-2,3-dihydroinden-1-ol |
| SMILES | CCCOCC1(O)CCc2c(F)cccc21 |
| InChI | InChI=1S/C13H17FO2/c1-2-8-16-9-13(15)7-6-10-11(13)4-3-5-12(10)14/h3-5,15H,2,6-9H2,1H3 |
| InChIKey | FDZDQFFKTZOMND-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|