About 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol
4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol (PubChem CID 83173066) has the molecular formula C14H13FO2
and a molecular weight of 232.25 g/mol. Its IUPAC name is 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol |
| PubChem CID | 83173066 |
| Molecular Formula | C14H13FO2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol |
| SMILES | OC1(Cc2ccoc2)CCc2c(F)cccc21 |
| InChI | InChI=1S/C14H13FO2/c15-13-3-1-2-12-11(13)4-6-14(12,16)8-10-5-7-17-9-10/h1-3,5,7,9,16H,4,6,8H2 |
| InChIKey | LJHWUUYKSJNYGV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol?
The IUPAC name of 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol (CID 83173066) is 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol.
What is the SMILES notation for 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol?
The canonical SMILES for 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol is OC1(Cc2ccoc2)CCc2c(F)cccc21.
What is the InChIKey of 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol?
The InChIKey is LJHWUUYKSJNYGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FO2/c15-13-3-1-2-12-11(13)4-6-14(12,16)8-10-5-7-17-9-10/h1-3,5,7,9,16H,4,6,8H2.
What are the key properties of 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol?
4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol has a molecular weight of 232.25 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-(furan-3-ylmethyl)-2,3-dihydroinden-1-ol is sourced from PubChem (CID 83173066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).