C12H16FNO — CID 83070139
1-(ethylaminomethyl)-4-fluoro-2,3-dihydroinden-1-ol (PubChem CID 83070139) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 1-(ethylaminomethyl)-4-fluoro-2,3-dihydroinden-1-ol.
| Compound Name | 1-(ethylaminomethyl)-4-fluoro-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 83070139 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-(ethylaminomethyl)-4-fluoro-2,3-dihydroinden-1-ol |
| SMILES | CCNCC1(O)CCc2c(F)cccc21 |
| InChI | InChI=1S/C12H16FNO/c1-2-14-8-12(15)7-6-9-10(12)4-3-5-11(9)13/h3-5,14-15H,2,6-8H2,1H3 |
| InChIKey | FRASLVPZKQFAJN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |