C14H21N3O3 — CID 83093722
2-azido-1-(3,4-dipropoxyphenyl)ethanol (PubChem CID 83093722) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-azido-1-(3,4-dipropoxyphenyl)ethanol.
| Compound Name | 2-azido-1-(3,4-dipropoxyphenyl)ethanol |
|---|---|
| PubChem CID | 83093722 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-azido-1-(3,4-dipropoxyphenyl)ethanol |
| SMILES | CCCOc1ccc(C(O)CN=[N+]=[N-])cc1OCCC |
| InChI | InChI=1S/C14H21N3O3/c1-3-7-19-13-6-5-11(12(18)10-16-17-15)9-14(13)20-8-4-2/h5-6,9,12,18H,3-4,7-8,10H2,1-2H3 |
| InChIKey | AQIAWAUCFFGYAM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|