C12H20N4O3 — CID 83097301
4-[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-N-methylmorpholine-3-carboxamide (PubChem CID 83097301) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83097301 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1CC(=O)N(C)CCC#N |
| InChI | InChI=1S/C12H20N4O3/c1-14-12(18)10-9-19-7-6-16(10)8-11(17)15(2)5-3-4-13/h10H,3,5-9H2,1-2H3,(H,14,18) |
| InChIKey | IEUNJJQKNCJUOS-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |