C12H15N3O6 — CID 83098732
5-[[(3-carbamoylmorpholine-4-carbonyl)amino]methyl]furan-2-carboxylic acid (PubChem CID 83098732) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is 5-[[(3-carbamoylmorpholine-4-carbonyl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(3-carbamoylmorpholine-4-carbonyl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 83098732 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-[[(3-carbamoylmorpholine-4-carbonyl)amino]methyl]furan-2-carboxylic acid |
| SMILES | NC(=O)C1COCCN1C(=O)NCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C12H15N3O6/c13-10(16)8-6-20-4-3-15(8)12(19)14-5-7-1-2-9(21-7)11(17)18/h1-2,8H,3-6H2,(H2,13,16)(H,14,19)(H,17,18) |
| InChIKey | YDVXQJOZSFSDQB-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |