C12H21N3O5 — CID 83096416
6-[(3-carbamoylmorpholine-4-carbonyl)amino]hexanoic acid (PubChem CID 83096416) has the molecular formula C12H21N3O5 and a molecular weight of 287.32 g/mol. Its IUPAC name is 6-[(3-carbamoylmorpholine-4-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(3-carbamoylmorpholine-4-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 83096416 |
| Molecular Formula | C12H21N3O5 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 6-[(3-carbamoylmorpholine-4-carbonyl)amino]hexanoic acid |
| SMILES | NC(=O)C1COCCN1C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C12H21N3O5/c13-11(18)9-8-20-7-6-15(9)12(19)14-5-3-1-2-4-10(16)17/h9H,1-8H2,(H2,13,18)(H,14,19)(H,16,17) |
| InChIKey | YACCODYDJIJBKN-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|