C10H15N3O5 — CID 112746698
(E)-4-[(3-carbamoylmorpholine-4-carbonyl)amino]but-2-enoic acid (PubChem CID 112746698) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is (E)-4-[(3-carbamoylmorpholine-4-carbonyl)amino]but-2-enoic acid.
| Compound Name | (E)-4-[(3-carbamoylmorpholine-4-carbonyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 112746698 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (E)-4-[(3-carbamoylmorpholine-4-carbonyl)amino]but-2-enoic acid |
| SMILES | NC(=O)C1COCCN1C(=O)NC/C=C/C(=O)O |
| InChI | InChI=1S/C10H15N3O5/c11-9(16)7-6-18-5-4-13(7)10(17)12-3-1-2-8(14)15/h1-2,7H,3-6H2,(H2,11,16)(H,12,17)(H,14,15)/b2-1+ |
| InChIKey | YMQQDYVXBWKNLC-OWOJBTEDSA-N |
| XLogP | -1.48 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|