C13H19N3 — CID 83127170
6-(1-aminoethyl)-N-propyl-N-prop-2-ynylpyridin-3-amine (PubChem CID 83127170) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 6-(1-aminoethyl)-N-propyl-N-prop-2-ynylpyridin-3-amine.
| Compound Name | 6-(1-aminoethyl)-N-propyl-N-prop-2-ynylpyridin-3-amine |
|---|---|
| PubChem CID | 83127170 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 6-(1-aminoethyl)-N-propyl-N-prop-2-ynylpyridin-3-amine |
| SMILES | C#CCN(CCC)c1ccc(C(C)N)nc1 |
| InChI | InChI=1S/C13H19N3/c1-4-8-16(9-5-2)12-6-7-13(11(3)14)15-10-12/h1,6-7,10-11H,5,8-9,14H2,2-3H3 |
| InChIKey | MJNCKSFPBYHXJN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|