C14H19N3 — CID 83127891
6-[(1R)-1-aminoethyl]-N-(cyclopropylmethyl)-N-prop-2-ynylpyridin-3-amine (PubChem CID 83127891) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 6-[(1R)-1-aminoethyl]-N-(cyclopropylmethyl)-N-prop-2-ynylpyridin-3-amine.
| Compound Name | 6-[(1R)-1-aminoethyl]-N-(cyclopropylmethyl)-N-prop-2-ynylpyridin-3-amine |
|---|---|
| PubChem CID | 83127891 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 6-[(1R)-1-aminoethyl]-N-(cyclopropylmethyl)-N-prop-2-ynylpyridin-3-amine |
| SMILES | C#CCN(CC1CC1)c1ccc([C@@H](C)N)nc1 |
| InChI | InChI=1S/C14H19N3/c1-3-8-17(10-12-4-5-12)13-6-7-14(11(2)15)16-9-13/h1,6-7,9,11-12H,4-5,8,10,15H2,2H3/t11-/m1/s1 |
| InChIKey | LFNVGLRYWPOIHW-LLVKDONJSA-N |
| XLogP | 1.95 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|