C15H12N4S — CID 83192964
2-quinolin-6-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 83192964) has the molecular formula C15H12N4S and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-quinolin-6-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-quinolin-6-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 83192964 |
| Molecular Formula | C15H12N4S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-quinolin-6-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ccc3ncccc3c2)nc2c1CSC2 |
| InChI | InChI=1S/C15H12N4S/c16-14-11-7-20-8-13(11)18-15(19-14)10-3-4-12-9(6-10)2-1-5-17-12/h1-6H,7-8H2,(H2,16,18,19) |
| InChIKey | NCOVWVBYDUAFRH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |