About [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine
[2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 83200676) has the molecular formula C15H24N4S
and a molecular weight of 292.45 g/mol. Its IUPAC name is [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| PubChem CID | 83200676 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | CCCC1CCC(c2nc3c(c(NN)n2)CSC3)CC1 |
| InChI | InChI=1S/C15H24N4S/c1-2-3-10-4-6-11(7-5-10)14-17-13-9-20-8-12(13)15(18-14)19-16/h10-11H,2-9,16H2,1H3,(H,17,18,19) |
| InChIKey | ASHWEGIQHLUKHD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
The IUPAC name of [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (CID 83200676) is [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine is CCCC1CCC(c2nc3c(c(NN)n2)CSC3)CC1.
What is the InChIKey of [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
The InChIKey is ASHWEGIQHLUKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4S/c1-2-3-10-4-6-11(7-5-10)14-17-13-9-20-8-12(13)15(18-14)19-16/h10-11H,2-9,16H2,1H3,(H,17,18,19).
What are the key properties of [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
[2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine has a molecular weight of 292.45 g/mol, XLogP of 3.58, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-propylcyclohexyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 83200676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).