C17H24N2O2 — CID 83206156
N-cycloheptyl-2-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)acetamide (PubChem CID 83206156) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-cycloheptyl-2-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)acetamide.
| Compound Name | N-cycloheptyl-2-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 83206156 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-cycloheptyl-2-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)acetamide |
| SMILES | O=C(Cn1cc2c(c1)C(=O)CCC2)NC1CCCCCC1 |
| InChI | InChI=1S/C17H24N2O2/c20-16-9-5-6-13-10-19(11-15(13)16)12-17(21)18-14-7-3-1-2-4-8-14/h10-11,14H,1-9,12H2,(H,18,21) |
| InChIKey | NXRKYJWTWGHSMW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |