C20H36N4O5S2 — CID 20927507
2-[3,4-bis(tert-butylsulfamoyl)pyrrol-1-yl]-N-cyclohexylacetamide (PubChem CID 20927507) has the molecular formula C20H36N4O5S2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 2-[3,4-bis(tert-butylsulfamoyl)pyrrol-1-yl]-N-cyclohexylacetamide.
| Compound Name | 2-[3,4-bis(tert-butylsulfamoyl)pyrrol-1-yl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 20927507 |
| Molecular Formula | C20H36N4O5S2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-[3,4-bis(tert-butylsulfamoyl)pyrrol-1-yl]-N-cyclohexylacetamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cn(CC(=O)NC2CCCCC2)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H36N4O5S2/c1-19(2,3)22-30(26,27)16-12-24(13-17(16)31(28,29)23-20(4,5)6)14-18(25)21-15-10-8-7-9-11-15/h12-13,15,22-23H,7-11,14H2,1-6H3,(H,21,25) |
| InChIKey | MNRMONQYUZIQMU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |