C13H12F2N2O4 — CID 83206441
2-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 83206441) has the molecular formula C13H12F2N2O4 and a molecular weight of 298.25 g/mol. Its IUPAC name is 2-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 83206441 |
| Molecular Formula | C13H12F2N2O4 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1C(=O)C(=O)c2c(F)ccc(F)c21 |
| InChI | InChI=1S/C13H12F2N2O4/c1-21-5-4-16-9(18)6-17-11-8(15)3-2-7(14)10(11)12(19)13(17)20/h2-3H,4-6H2,1H3,(H,16,18) |
| InChIKey | MPVQSQHEOGRWPH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|