C14H27NO5S — CID 83207465
tert-butyl 3-methyl-3-(2-methylsulfonylethoxy)piperidine-1-carboxylate (PubChem CID 83207465) has the molecular formula C14H27NO5S and a molecular weight of 321.44 g/mol. Its IUPAC name is tert-butyl 3-methyl-3-(2-methylsulfonylethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-3-(2-methylsulfonylethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 83207465 |
| Molecular Formula | C14H27NO5S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | tert-butyl 3-methyl-3-(2-methylsulfonylethoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C)(OCCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H27NO5S/c1-13(2,3)20-12(16)15-8-6-7-14(4,11-15)19-9-10-21(5,17)18/h6-11H2,1-5H3 |
| InChIKey | NDRUWAXHYDDBBY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |