About 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile
4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile (PubChem CID 83208607) has the molecular formula C16H13FN2O
and a molecular weight of 268.29 g/mol. Its IUPAC name is 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile |
| PubChem CID | 83208607 |
| Molecular Formula | C16H13FN2O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)c(Cn2cc3c(c2)C(=O)CCC3)c1 |
| InChI | InChI=1S/C16H13FN2O/c17-15-5-4-11(7-18)6-13(15)9-19-8-12-2-1-3-16(20)14(12)10-19/h4-6,8,10H,1-3,9H2 |
| InChIKey | DGEJTBRRVZLYNF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile?
The IUPAC name of 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile (CID 83208607) is 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile.
What is the SMILES notation for 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile?
The canonical SMILES for 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile is N#Cc1ccc(F)c(Cn2cc3c(c2)C(=O)CCC3)c1.
What is the InChIKey of 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile?
The InChIKey is DGEJTBRRVZLYNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O/c17-15-5-4-11(7-18)6-13(15)9-19-8-12-2-1-3-16(20)14(12)10-19/h4-6,8,10H,1-3,9H2.
What are the key properties of 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile?
4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile has a molecular weight of 268.29 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-[(7-oxo-5,6-dihydro-4H-isoindol-2-yl)methyl]benzonitrile is sourced from PubChem (CID 83208607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).