C13H19N3 — CID 83212215
5-(4-amino-4,5,6,7-tetrahydroisoindol-2-yl)pentanenitrile (PubChem CID 83212215) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 5-(4-amino-4,5,6,7-tetrahydroisoindol-2-yl)pentanenitrile.
| Compound Name | 5-(4-amino-4,5,6,7-tetrahydroisoindol-2-yl)pentanenitrile |
|---|---|
| PubChem CID | 83212215 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 5-(4-amino-4,5,6,7-tetrahydroisoindol-2-yl)pentanenitrile |
| SMILES | N#CCCCCn1cc2c(c1)C(N)CCC2 |
| InChI | InChI=1S/C13H19N3/c14-7-2-1-3-8-16-9-11-5-4-6-13(15)12(11)10-16/h9-10,13H,1-6,8,15H2 |
| InChIKey | ZQNOWHLUUOLIRD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|