C13H22N2O — CID 83212759
5-(4-amino-4,5,6,7-tetrahydroisoindol-2-yl)pentan-1-ol (PubChem CID 83212759) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-(4-amino-4,5,6,7-tetrahydroisoindol-2-yl)pentan-1-ol.
| Compound Name | 5-(4-amino-4,5,6,7-tetrahydroisoindol-2-yl)pentan-1-ol |
|---|---|
| PubChem CID | 83212759 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 5-(4-amino-4,5,6,7-tetrahydroisoindol-2-yl)pentan-1-ol |
| SMILES | NC1CCCc2cn(CCCCCO)cc21 |
| InChI | InChI=1S/C13H22N2O/c14-13-6-4-5-11-9-15(10-12(11)13)7-2-1-3-8-16/h9-10,13,16H,1-8,14H2 |
| InChIKey | ZZYJEEWPHMXNAD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|