C13H16ClN3O2S — CID 83223405
N-(3-aminopropyl)-2-chloro-3-methylquinoline-8-sulfonamide (PubChem CID 83223405) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-chloro-3-methylquinoline-8-sulfonamide.
| Compound Name | N-(3-aminopropyl)-2-chloro-3-methylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 83223405 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(3-aminopropyl)-2-chloro-3-methylquinoline-8-sulfonamide |
| SMILES | Cc1cc2cccc(S(=O)(=O)NCCCN)c2nc1Cl |
| InChI | InChI=1S/C13H16ClN3O2S/c1-9-8-10-4-2-5-11(12(10)17-13(9)14)20(18,19)16-7-3-6-15/h2,4-5,8,16H,3,6-7,15H2,1H3 |
| InChIKey | UMEILKMVSORIDK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|