C13H22N2O — CID 83243483
6-cycloheptyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 83243483) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 6-cycloheptyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one.
| Compound Name | 6-cycloheptyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one |
|---|---|
| PubChem CID | 83243483 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 6-cycloheptyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | CC1NC2(CC2)C(=O)N1C1CCCCCC1 |
| InChI | InChI=1S/C13H22N2O/c1-10-14-13(8-9-13)12(16)15(10)11-6-4-2-3-5-7-11/h10-11,14H,2-9H2,1H3 |
| InChIKey | QMKIWUIHPRSDTF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |