C13H20N2O4S — CID 83271643
7-(diethylaminomethyl)-2,3-dihydro-1,4-benzodioxine-5-sulfonamide (PubChem CID 83271643) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 7-(diethylaminomethyl)-2,3-dihydro-1,4-benzodioxine-5-sulfonamide.
| Compound Name | 7-(diethylaminomethyl)-2,3-dihydro-1,4-benzodioxine-5-sulfonamide |
|---|---|
| PubChem CID | 83271643 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 7-(diethylaminomethyl)-2,3-dihydro-1,4-benzodioxine-5-sulfonamide |
| SMILES | CCN(CC)Cc1cc2c(c(S(N)(=O)=O)c1)OCCO2 |
| InChI | InChI=1S/C13H20N2O4S/c1-3-15(4-2)9-10-7-11-13(19-6-5-18-11)12(8-10)20(14,16)17/h7-8H,3-6,9H2,1-2H3,(H2,14,16,17) |
| InChIKey | BARIBEWNIDQAKW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |