C10H8N4O — CID 83383120
4-benzyl-3-isocyanato-1,2,4-triazole (PubChem CID 83383120) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 4-benzyl-3-isocyanato-1,2,4-triazole.
| Compound Name | 4-benzyl-3-isocyanato-1,2,4-triazole |
|---|---|
| PubChem CID | 83383120 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-benzyl-3-isocyanato-1,2,4-triazole |
| SMILES | O=C=Nc1nncn1Cc1ccccc1 |
| InChI | InChI=1S/C10H8N4O/c15-8-11-10-13-12-7-14(10)6-9-4-2-1-3-5-9/h1-5,7H,6H2 |
| InChIKey | PIQUFSGUIHOYMW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|