C8H5NO3S2 — CID 83494071
2-oxo-4-thiophen-2-yl-3H-1,3-thiazole-5-carboxylic acid (PubChem CID 83494071) has the molecular formula C8H5NO3S2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-oxo-4-thiophen-2-yl-3H-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-oxo-4-thiophen-2-yl-3H-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 83494071 |
| Molecular Formula | C8H5NO3S2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | 2-oxo-4-thiophen-2-yl-3H-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(=O)[nH]c1-c1cccs1 |
| InChI | InChI=1S/C8H5NO3S2/c10-7(11)6-5(9-8(12)14-6)4-2-1-3-13-4/h1-3H,(H,9,12)(H,10,11) |
| InChIKey | XALGWCAZAJHKBC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |